C49H32N4O — CID 176755159
1-(4,6-diphenyl-1,3,5-triazin-2-yl)-N-(2,3,4,5,6-pentadeuteriophenyl)-N-(4-phenylphenyl)naphtho[2,3-b][1]benzofuran-6-amine (PubChem CID 176755159) has the molecular formula C49H32N4O and a molecular weight of 697.85 g/mol. Its IUPAC name is 1-(4,6-diphenyl-1,3,5-triazin-2-yl)-N-(2,3,4,5,6-pentadeuteriophenyl)-N-(4-phenylphenyl)naphtho[2,3-b][1]benzofuran-6-amine.
| Compound Name | 1-(4,6-diphenyl-1,3,5-triazin-2-yl)-N-(2,3,4,5,6-pentadeuteriophenyl)-N-(4-phenylphenyl)naphtho[2,3-b][1]benzofuran-6-amine |
|---|---|
| PubChem CID | 176755159 |
| Molecular Formula | C49H32N4O |
| Molecular Weight | 697.85 g/mol |
| Exact Mass | 697.29 |
| IUPAC Name | 1-(4,6-diphenyl-1,3,5-triazin-2-yl)-N-(2,3,4,5,6-pentadeuteriophenyl)-N-(4-phenylphenyl)naphtho[2,3-b][1]benzofuran-6-amine |
| SMILES | [2H]c1c([2H])c([2H])c(N(c2ccc(-c3ccccc3)cc2)c2c3ccccc3cc3c2oc2cccc(-c4nc(-c5ccccc5)nc(-c5ccccc5)n4)c23)c([2H])c1[2H] |
| InChI | InChI=1S/C49H32N4O/c1-5-16-33(17-6-1)34-28-30-39(31-29-34)53(38-23-11-4-12-24-38)45-40-25-14-13-22-37(40)32-42-44-41(26-15-27-43(44)54-46(42)45)49-51-47(35-18-7-2-8-19-35)50-48(52-49)36-20-9-3-10-21-36/h1-32H/i4D,11D,12D,23D,24D |
| InChIKey | MTCVQDBOWFSUOG-ZDRLNADSSA-N |
| XLogP | 13.06 |
| TPSA | 55.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 697.85 |
| LogP ≤ 5 | 13.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |