C41H50 — CID 176756864
1,1,4,4-tetramethyl-6-[2-methyl-3-[2,3,5,6-tetradeuterio-4-(2,4-ditert-butyl-3,5,6-trideuteriophenyl)phenyl]phenyl]-2,3-dihydronaphthalene (PubChem CID 176756864) has the molecular formula C41H50 and a molecular weight of 549.89 g/mol. Its IUPAC name is 1,1,4,4-tetramethyl-6-[2-methyl-3-[2,3,5,6-tetradeuterio-4-(2,4-ditert-butyl-3,5,6-trideuteriophenyl)phenyl]phenyl]-2,3-dihydronaphthalene.
| Compound Name | 1,1,4,4-tetramethyl-6-[2-methyl-3-[2,3,5,6-tetradeuterio-4-(2,4-ditert-butyl-3,5,6-trideuteriophenyl)phenyl]phenyl]-2,3-dihydronaphthalene |
|---|---|
| PubChem CID | 176756864 |
| Molecular Formula | C41H50 |
| Molecular Weight | 549.89 g/mol |
| Exact Mass | 549.44 |
| IUPAC Name | 1,1,4,4-tetramethyl-6-[2-methyl-3-[2,3,5,6-tetradeuterio-4-(2,4-ditert-butyl-3,5,6-trideuteriophenyl)phenyl]phenyl]-2,3-dihydronaphthalene |
| SMILES | [2H]c1c([2H])c(-c2c([2H])c([2H])c(C(C)(C)C)c([2H])c2C(C)(C)C)c([2H])c([2H])c1-c1cccc(-c2ccc3c(c2)C(C)(C)CCC3(C)C)c1C |
| InChI | InChI=1S/C41H50/c1-27-32(13-12-14-33(27)30-19-22-35-37(25-30)41(10,11)24-23-40(35,8)9)28-15-17-29(18-16-28)34-21-20-31(38(2,3)4)26-36(34)39(5,6)7/h12-22,25-26H,23-24H2,1-11H3/i15D,16D,17D,18D,20D,21D,26D |
| InChIKey | KWRKENGIJHHPRT-AFHMPJPQSA-N |
| XLogP | 11.94 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.89 |
| LogP ≤ 5 | 11.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |