C17H12N2S — CID 176757029
7-methyl-5-pyridin-2-ylthieno[3,2-h]quinoline (PubChem CID 176757029) has the molecular formula C17H12N2S and a molecular weight of 276.36 g/mol. Its IUPAC name is 7-methyl-5-pyridin-2-ylthieno[3,2-h]quinoline.
| Compound Name | 7-methyl-5-pyridin-2-ylthieno[3,2-h]quinoline |
|---|---|
| PubChem CID | 176757029 |
| Molecular Formula | C17H12N2S |
| Molecular Weight | 276.36 g/mol |
| Exact Mass | 276.07 |
| IUPAC Name | 7-methyl-5-pyridin-2-ylthieno[3,2-h]quinoline |
| SMILES | Cc1cnc2c(c1)c(-c1ccccn1)cc1ccsc12 |
| InChI | InChI=1S/C17H12N2S/c1-11-8-14-13(15-4-2-3-6-18-15)9-12-5-7-20-17(12)16(14)19-10-11/h2-10H,1H3 |
| InChIKey | WCICEQVFICMSAK-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.36 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |