C13H26N2O — CID 176757876
(E)-N-[3-(dimethylamino)propyl]-5,5-dimethylhex-2-enamide (PubChem CID 176757876) has the molecular formula C13H26N2O and a molecular weight of 226.36 g/mol. Its IUPAC name is (E)-N-[3-(dimethylamino)propyl]-5,5-dimethylhex-2-enamide.
| Compound Name | (E)-N-[3-(dimethylamino)propyl]-5,5-dimethylhex-2-enamide |
|---|---|
| PubChem CID | 176757876 |
| Molecular Formula | C13H26N2O |
| Molecular Weight | 226.36 g/mol |
| Exact Mass | 226.20 |
| IUPAC Name | (E)-N-[3-(dimethylamino)propyl]-5,5-dimethylhex-2-enamide |
| SMILES | CN(C)CCCNC(=O)/C=C/CC(C)(C)C |
| InChI | InChI=1S/C13H26N2O/c1-13(2,3)9-6-8-12(16)14-10-7-11-15(4)5/h6,8H,7,9-11H2,1-5H3,(H,14,16)/b8-6+ |
| InChIKey | QARCNQHTJBWGPS-SOFGYWHQSA-N |
| XLogP | 2.05 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.36 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|