C11H20FN — CID 176776126
(2R,8R)-5,5-dideuterio-8-(1,1-dideuterio-2-methylpropyl)-2-fluoro-2,3,6,7-tetrahydro-1H-pyrrolizine (PubChem CID 176776126) has the molecular formula C11H20FN and a molecular weight of 189.31 g/mol. Its IUPAC name is (2R,8R)-5,5-dideuterio-8-(1,1-dideuterio-2-methylpropyl)-2-fluoro-2,3,6,7-tetrahydro-1H-pyrrolizine.
| Compound Name | (2R,8R)-5,5-dideuterio-8-(1,1-dideuterio-2-methylpropyl)-2-fluoro-2,3,6,7-tetrahydro-1H-pyrrolizine |
|---|---|
| PubChem CID | 176776126 |
| Molecular Formula | C11H20FN |
| Molecular Weight | 189.31 g/mol |
| Exact Mass | 189.18 |
| IUPAC Name | (2R,8R)-5,5-dideuterio-8-(1,1-dideuterio-2-methylpropyl)-2-fluoro-2,3,6,7-tetrahydro-1H-pyrrolizine |
| SMILES | [2H]C1([2H])CC[C@@]2(C([2H])([2H])C(C)C)C[C@@H](F)CN12 |
| InChI | InChI=1S/C11H20FN/c1-9(2)6-11-4-3-5-13(11)8-10(12)7-11/h9-10H,3-8H2,1-2H3/t10-,11-/m1/s1/i5D2,6D2 |
| InChIKey | YDXPWRMIHUPXCY-XLGMKMEFSA-N |
| XLogP | 2.61 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.31 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |