C12H27NSi — CID 176797678
1-tert-butyl-4,4-diethyl-1,4-azasilinane (PubChem CID 176797678) has the molecular formula C12H27NSi and a molecular weight of 213.44 g/mol. Its IUPAC name is 1-tert-butyl-4,4-diethyl-1,4-azasilinane.
| Compound Name | 1-tert-butyl-4,4-diethyl-1,4-azasilinane |
|---|---|
| PubChem CID | 176797678 |
| Molecular Formula | C12H27NSi |
| Molecular Weight | 213.44 g/mol |
| Exact Mass | 213.19 |
| IUPAC Name | 1-tert-butyl-4,4-diethyl-1,4-azasilinane |
| SMILES | CC[Si]1(CC)CCN(C(C)(C)C)CC1 |
| InChI | InChI=1S/C12H27NSi/c1-6-14(7-2)10-8-13(9-11-14)12(3,4)5/h6-11H2,1-5H3 |
| InChIKey | CANQSTUIELWQDQ-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.44 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|