C37H34N2O4S5 — CID 176804801
2-[[2-(1,3-benzothiazol-2-ylsulfanylmethyl)-2-[(4-thianthren-1-ylphenyl)sulfanylmethyl]butoxy]carbonylamino]ethyl prop-2-enoate (PubChem CID 176804801) has the molecular formula C37H34N2O4S5 and a molecular weight of 731.02 g/mol. Its IUPAC name is 2-[[2-(1,3-benzothiazol-2-ylsulfanylmethyl)-2-[(4-thianthren-1-ylphenyl)sulfanylmethyl]butoxy]carbonylamino]ethyl prop-2-enoate.
| Compound Name | 2-[[2-(1,3-benzothiazol-2-ylsulfanylmethyl)-2-[(4-thianthren-1-ylphenyl)sulfanylmethyl]butoxy]carbonylamino]ethyl prop-2-enoate |
|---|---|
| PubChem CID | 176804801 |
| Molecular Formula | C37H34N2O4S5 |
| Molecular Weight | 731.02 g/mol |
| Exact Mass | 730.11 |
| IUPAC Name | 2-[[2-(1,3-benzothiazol-2-ylsulfanylmethyl)-2-[(4-thianthren-1-ylphenyl)sulfanylmethyl]butoxy]carbonylamino]ethyl prop-2-enoate |
| SMILES | C=CC(=O)OCCNC(=O)OCC(CC)(CSc1ccc(-c2cccc3c2Sc2ccccc2S3)cc1)CSc1nc2ccccc2s1 |
| InChI | InChI=1S/C37H34N2O4S5/c1-3-33(40)42-21-20-38-35(41)43-22-37(4-2,24-45-36-39-28-11-5-6-12-29(28)48-36)23-44-26-18-16-25(17-19-26)27-10-9-15-32-34(27)47-31-14-8-7-13-30(31)46-32/h3,5-19H,1,4,20-24H2,2H3,(H,38,41) |
| InChIKey | UXECNWRQXIBNGH-UHFFFAOYSA-N |
| XLogP | 10.32 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 731.02 |
| LogP ≤ 5 | 10.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|