C12H12N2O2S — CID 129146688
2-(1,3-benzothiazol-2-ylamino)ethyl prop-2-enoate (PubChem CID 129146688) has the molecular formula C12H12N2O2S and a molecular weight of 248.31 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-2-ylamino)ethyl prop-2-enoate.
| Compound Name | 2-(1,3-benzothiazol-2-ylamino)ethyl prop-2-enoate |
|---|---|
| PubChem CID | 129146688 |
| Molecular Formula | C12H12N2O2S |
| Molecular Weight | 248.31 g/mol |
| Exact Mass | 248.06 |
| IUPAC Name | 2-(1,3-benzothiazol-2-ylamino)ethyl prop-2-enoate |
| SMILES | C=CC(=O)OCCNc1nc2ccccc2s1 |
| InChI | InChI=1S/C12H12N2O2S/c1-2-11(15)16-8-7-13-12-14-9-5-3-4-6-10(9)17-12/h2-6H,1,7-8H2,(H,13,14) |
| InChIKey | SQHZNNHPZCZQBI-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.31 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|