C8H13NO3 — CID 176808093
(2E,4E,6S,7R)-6-azaniumyl-7-hydroxyocta-2,4-dienoate (PubChem CID 176808093) has the molecular formula C8H13NO3 and a molecular weight of 171.20 g/mol. Its IUPAC name is (2E,4E,6S,7R)-6-azaniumyl-7-hydroxyocta-2,4-dienoate.
| Compound Name | (2E,4E,6S,7R)-6-azaniumyl-7-hydroxyocta-2,4-dienoate |
|---|---|
| PubChem CID | 176808093 |
| Molecular Formula | C8H13NO3 |
| Molecular Weight | 171.20 g/mol |
| Exact Mass | 171.09 |
| IUPAC Name | (2E,4E,6S,7R)-6-azaniumyl-7-hydroxyocta-2,4-dienoate |
| SMILES | C[C@@H](O)[C@@H]([NH3+])/C=C/C=C/C(=O)[O-] |
| InChI | InChI=1S/C8H13NO3/c1-6(10)7(9)4-2-3-5-8(11)12/h2-7,10H,9H2,1H3,(H,11,12)/b4-2+,5-3+/t6-,7+/m1/s1 |
| InChIKey | UBDHRDHDYOTZMN-FRYAYZIISA-N |
| XLogP | -2.16 |
| TPSA | 88.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.20 |
| LogP ≤ 5 | -2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|