C30H42BFN2O6 — CID 176811540
methyl 1-(cyclopropylmethyl)-3-fluoro-2-[(3S)-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-3-yl]-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indole-5-carboxylate (PubChem CID 176811540) has the molecular formula C30H42BFN2O6 and a molecular weight of 556.48 g/mol. Its IUPAC name is methyl 1-(cyclopropylmethyl)-3-fluoro-2-[(3S)-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-3-yl]-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indole-5-carboxylate.
| Compound Name | methyl 1-(cyclopropylmethyl)-3-fluoro-2-[(3S)-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-3-yl]-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indole-5-carboxylate |
|---|---|
| PubChem CID | 176811540 |
| Molecular Formula | C30H42BFN2O6 |
| Molecular Weight | 556.48 g/mol |
| Exact Mass | 556.31 |
| IUPAC Name | methyl 1-(cyclopropylmethyl)-3-fluoro-2-[(3S)-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-3-yl]-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indole-5-carboxylate |
| SMILES | COC(=O)c1cc(B2OC(C)(C)C(C)(C)O2)c2c(c1)c(F)c([C@H]1CCCN(C(=O)OC(C)(C)C)C1)n2CC1CC1 |
| InChI | InChI=1S/C30H42BFN2O6/c1-28(2,3)38-27(36)33-13-9-10-19(17-33)24-23(32)21-14-20(26(35)37-8)15-22(25(21)34(24)16-18-11-12-18)31-39-29(4,5)30(6,7)40-31/h14-15,18-19H,9-13,16-17H2,1-8H3/t19-/m0/s1 |
| InChIKey | OLTDHVCTONTCSC-IBGZPJMESA-N |
| XLogP | 5.39 |
| TPSA | 79.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.48 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|