C47H39N3 — CID 176825136
2,4-diphenyl-6-[4-phenyl-3-(1,1,3,3-tetradeuterio-5,5-dimethylspiro[cyclohexane-2,9'-fluorene]-2'-yl)phenyl]-1,3,5-triazine (PubChem CID 176825136) has the molecular formula C47H39N3 and a molecular weight of 649.87 g/mol. Its IUPAC name is 2,4-diphenyl-6-[4-phenyl-3-(1,1,3,3-tetradeuterio-5,5-dimethylspiro[cyclohexane-2,9'-fluorene]-2'-yl)phenyl]-1,3,5-triazine.
| Compound Name | 2,4-diphenyl-6-[4-phenyl-3-(1,1,3,3-tetradeuterio-5,5-dimethylspiro[cyclohexane-2,9'-fluorene]-2'-yl)phenyl]-1,3,5-triazine |
|---|---|
| PubChem CID | 176825136 |
| Molecular Formula | C47H39N3 |
| Molecular Weight | 649.87 g/mol |
| Exact Mass | 649.34 |
| IUPAC Name | 2,4-diphenyl-6-[4-phenyl-3-(1,1,3,3-tetradeuterio-5,5-dimethylspiro[cyclohexane-2,9'-fluorene]-2'-yl)phenyl]-1,3,5-triazine |
| SMILES | [2H]C1([2H])CC(C)(C)CC([2H])([2H])C12c1ccccc1-c1ccc(-c3cc(-c4nc(-c5ccccc5)nc(-c5ccccc5)n4)ccc3-c3ccccc3)cc12 |
| InChI | InChI=1S/C47H39N3/c1-46(2)26-28-47(29-27-46)41-21-13-12-20-38(41)39-25-22-35(31-42(39)47)40-30-36(23-24-37(40)32-14-6-3-7-15-32)45-49-43(33-16-8-4-9-17-33)48-44(50-45)34-18-10-5-11-19-34/h3-25,30-31H,26-29H2,1-2H3/i28D2,29D2 |
| InChIKey | YWSSYMVJAZEIMD-JSAXZSKBSA-N |
| XLogP | 12.07 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.87 |
| LogP ≤ 5 | 12.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |