C38H35N3 — CID 176825215
CID 176825215 (PubChem CID 176825215) has the molecular formula C38H35N3 and a molecular weight of 537.74 g/mol.
| Compound Name | CID 176825215 |
|---|---|
| PubChem CID | 176825215 |
| Molecular Formula | C38H35N3 |
| Molecular Weight | 537.74 g/mol |
| Exact Mass | 537.31 |
| IUPAC Name | — |
| SMILES | [2H]C1([2H])CC2(CCCCC2)CC([2H])([2H])C12c1ccccc1-c1ccc(-c3nc(-c4ccccc4)nc(-c4ccccc4)n3)cc12 |
| InChI | InChI=1S/C38H35N3/c1-4-12-27(13-5-1)34-39-35(28-14-6-2-7-15-28)41-36(40-34)29-18-19-31-30-16-8-9-17-32(30)38(33(31)26-29)24-22-37(23-25-38)20-10-3-11-21-37/h1-2,4-9,12-19,26H,3,10-11,20-25H2/i24D2,25D2 |
| InChIKey | HJVUKSWKDQHTPV-TZGJBPQYSA-N |
| XLogP | 9.66 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.74 |
| LogP ≤ 5 | 9.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |