C62H51N3Si — CID 176825213
CID 176825213 (PubChem CID 176825213) has the molecular formula C62H51N3Si and a molecular weight of 870.22 g/mol.
| Compound Name | CID 176825213 |
|---|---|
| PubChem CID | 176825213 |
| Molecular Formula | C62H51N3Si |
| Molecular Weight | 870.22 g/mol |
| Exact Mass | 869.41 |
| IUPAC Name | — |
| SMILES | [2H]C1([2H])CC2(CCCCC2)CC([2H])([2H])C12c1ccccc1-c1ccc(-c3ccc4c(c3)[Si](c3ccccc3)(c3ccccc3)c3cc(-c5nc(-c6ccccc6)nc(-c6ccccc6)n5)ccc3-4)cc12 |
| InChI | InChI=1S/C62H51N3Si/c1-6-18-43(19-7-1)58-63-59(44-20-8-2-9-21-44)65-60(64-58)47-30-33-53-52-32-29-46(41-56(52)66(57(53)42-47,48-22-10-3-11-23-48)49-24-12-4-13-25-49)45-28-31-51-50-26-14-15-27-54(50)62(55(51)40-45)38-36-61(37-39-62)34-16-5-17-35-61/h1-4,6-15,18-33,40-42H,5,16-17,34-39H2/i38D2,39D2 |
| InChIKey | KTTOVLCMTWIWJC-ZDKGDNNSSA-N |
| XLogP | 12.69 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 870.22 |
| LogP ≤ 5 | 12.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|