C40H33N3 — CID 176825067
2-[2-methyl-4-(1,1,3,3-tetradeuteriospiro[cyclohexane-2,9'-fluorene]-2'-yl)phenyl]-4,6-diphenyl-1,3,5-triazine (PubChem CID 176825067) has the molecular formula C40H33N3 and a molecular weight of 559.75 g/mol. Its IUPAC name is 2-[2-methyl-4-(1,1,3,3-tetradeuteriospiro[cyclohexane-2,9'-fluorene]-2'-yl)phenyl]-4,6-diphenyl-1,3,5-triazine.
| Compound Name | 2-[2-methyl-4-(1,1,3,3-tetradeuteriospiro[cyclohexane-2,9'-fluorene]-2'-yl)phenyl]-4,6-diphenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 176825067 |
| Molecular Formula | C40H33N3 |
| Molecular Weight | 559.75 g/mol |
| Exact Mass | 559.29 |
| IUPAC Name | 2-[2-methyl-4-(1,1,3,3-tetradeuteriospiro[cyclohexane-2,9'-fluorene]-2'-yl)phenyl]-4,6-diphenyl-1,3,5-triazine |
| SMILES | [2H]C1([2H])CCCC([2H])([2H])C12c1ccccc1-c1ccc(-c3ccc(-c4nc(-c5ccccc5)nc(-c5ccccc5)n4)c(C)c3)cc12 |
| InChI | InChI=1S/C40H33N3/c1-27-25-30(31-20-22-34-33-17-9-10-18-35(33)40(36(34)26-31)23-11-4-12-24-40)19-21-32(27)39-42-37(28-13-5-2-6-14-28)41-38(43-39)29-15-7-3-8-16-29/h2-3,5-10,13-22,25-26H,4,11-12,23-24H2,1H3/i23D2,24D2 |
| InChIKey | UBFFSTFGZQIEFT-VBUDNUALSA-N |
| XLogP | 10.08 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.75 |
| LogP ≤ 5 | 10.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |