C46H37N3 — CID 176825239
2-[4-methyl-3-[3-(1,1,3,3-tetradeuteriospiro[cyclohexane-2,9'-fluorene]-2'-yl)phenyl]phenyl]-4,6-diphenyl-1,3,5-triazine (PubChem CID 176825239) has the molecular formula C46H37N3 and a molecular weight of 635.85 g/mol. Its IUPAC name is 2-[4-methyl-3-[3-(1,1,3,3-tetradeuteriospiro[cyclohexane-2,9'-fluorene]-2'-yl)phenyl]phenyl]-4,6-diphenyl-1,3,5-triazine.
| Compound Name | 2-[4-methyl-3-[3-(1,1,3,3-tetradeuteriospiro[cyclohexane-2,9'-fluorene]-2'-yl)phenyl]phenyl]-4,6-diphenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 176825239 |
| Molecular Formula | C46H37N3 |
| Molecular Weight | 635.85 g/mol |
| Exact Mass | 635.32 |
| IUPAC Name | 2-[4-methyl-3-[3-(1,1,3,3-tetradeuteriospiro[cyclohexane-2,9'-fluorene]-2'-yl)phenyl]phenyl]-4,6-diphenyl-1,3,5-triazine |
| SMILES | [2H]C1([2H])CCCC([2H])([2H])C12c1ccccc1-c1ccc(-c3cccc(-c4cc(-c5nc(-c6ccccc6)nc(-c6ccccc6)n5)ccc4C)c3)cc12 |
| InChI | InChI=1S/C46H37N3/c1-31-22-23-37(45-48-43(32-14-5-2-6-15-32)47-44(49-45)33-16-7-3-8-17-33)29-40(31)36-19-13-18-34(28-36)35-24-25-39-38-20-9-10-21-41(38)46(42(39)30-35)26-11-4-12-27-46/h2-3,5-10,13-25,28-30H,4,11-12,26-27H2,1H3/i26D2,27D2 |
| InChIKey | OBDLCCDTMLQJDO-LXPRZCISSA-N |
| XLogP | 11.75 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.85 |
| LogP ≤ 5 | 11.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |