C45H35N3 — CID 176825227
2,4-diphenyl-6-[2-[3-(1,1,3,3-tetradeuteriospiro[cyclohexane-2,9'-fluorene]-2'-yl)phenyl]phenyl]-1,3,5-triazine (PubChem CID 176825227) has the molecular formula C45H35N3 and a molecular weight of 621.82 g/mol. Its IUPAC name is 2,4-diphenyl-6-[2-[3-(1,1,3,3-tetradeuteriospiro[cyclohexane-2,9'-fluorene]-2'-yl)phenyl]phenyl]-1,3,5-triazine.
| Compound Name | 2,4-diphenyl-6-[2-[3-(1,1,3,3-tetradeuteriospiro[cyclohexane-2,9'-fluorene]-2'-yl)phenyl]phenyl]-1,3,5-triazine |
|---|---|
| PubChem CID | 176825227 |
| Molecular Formula | C45H35N3 |
| Molecular Weight | 621.82 g/mol |
| Exact Mass | 621.31 |
| IUPAC Name | 2,4-diphenyl-6-[2-[3-(1,1,3,3-tetradeuteriospiro[cyclohexane-2,9'-fluorene]-2'-yl)phenyl]phenyl]-1,3,5-triazine |
| SMILES | [2H]C1([2H])CCCC([2H])([2H])C12c1ccccc1-c1ccc(-c3cccc(-c4ccccc4-c4nc(-c5ccccc5)nc(-c5ccccc5)n4)c3)cc12 |
| InChI | InChI=1S/C45H35N3/c1-4-15-31(16-5-1)42-46-43(32-17-6-2-7-18-32)48-44(47-42)39-23-9-8-21-36(39)35-20-14-19-33(29-35)34-25-26-38-37-22-10-11-24-40(37)45(41(38)30-34)27-12-3-13-28-45/h1-2,4-11,14-26,29-30H,3,12-13,27-28H2/i27D2,28D2 |
| InChIKey | SBUKSAHRGZMWGG-VVQNJOSMSA-N |
| XLogP | 11.44 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.82 |
| LogP ≤ 5 | 11.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |