C17H27N3O2 — CID 176835402
butyl N-[4,5-di(cyclobutyl)-2-methylpyrazol-3-yl]carbamate (PubChem CID 176835402) has the molecular formula C17H27N3O2 and a molecular weight of 305.42 g/mol. Its IUPAC name is butyl N-[4,5-di(cyclobutyl)-2-methylpyrazol-3-yl]carbamate.
| Compound Name | butyl N-[4,5-di(cyclobutyl)-2-methylpyrazol-3-yl]carbamate |
|---|---|
| PubChem CID | 176835402 |
| Molecular Formula | C17H27N3O2 |
| Molecular Weight | 305.42 g/mol |
| Exact Mass | 305.21 |
| IUPAC Name | butyl N-[4,5-di(cyclobutyl)-2-methylpyrazol-3-yl]carbamate |
| SMILES | CCCCOC(=O)Nc1c(C2CCC2)c(C2CCC2)nn1C |
| InChI | InChI=1S/C17H27N3O2/c1-3-4-11-22-17(21)18-16-14(12-7-5-8-12)15(19-20(16)2)13-9-6-10-13/h12-13H,3-11H2,1-2H3,(H,18,21) |
| InChIKey | RPUGTKMNUHODRI-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.42 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|