C19H37FN2 — CID 176841251
1-tert-butyl-4-[(4-tert-butyl-3-fluorocyclohexyl)methyl]piperazine (PubChem CID 176841251) has the molecular formula C19H37FN2 and a molecular weight of 312.52 g/mol. Its IUPAC name is 1-tert-butyl-4-[(4-tert-butyl-3-fluorocyclohexyl)methyl]piperazine.
| Compound Name | 1-tert-butyl-4-[(4-tert-butyl-3-fluorocyclohexyl)methyl]piperazine |
|---|---|
| PubChem CID | 176841251 |
| Molecular Formula | C19H37FN2 |
| Molecular Weight | 312.52 g/mol |
| Exact Mass | 312.29 |
| IUPAC Name | 1-tert-butyl-4-[(4-tert-butyl-3-fluorocyclohexyl)methyl]piperazine |
| SMILES | CC(C)(C)C1CCC(CN2CCN(C(C)(C)C)CC2)CC1F |
| InChI | InChI=1S/C19H37FN2/c1-18(2,3)16-8-7-15(13-17(16)20)14-21-9-11-22(12-10-21)19(4,5)6/h15-17H,7-14H2,1-6H3 |
| InChIKey | CZXAQEXJHNBUMZ-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.52 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |