C65H50GeN5OPt-3 — CID 176843757
CID 176843757 (PubChem CID 176843757) has the molecular formula C65H50GeN5OPt-3 and a molecular weight of 1184.84 g/mol.
| Compound Name | CID 176843757 |
|---|---|
| PubChem CID | 176843757 |
| Molecular Formula | C65H50GeN5OPt-3 |
| Molecular Weight | 1184.84 g/mol |
| Exact Mass | 1185.29 |
| IUPAC Name | — |
| SMILES | [CH2-]N(c1ccccc1Nc1[c-]c(Oc2[c-]c3c4c(c2)[Ge]2(c5ccccc5N(C)c5ccccc52)c2cccc(c24)n3-c2cc(C(C)(C)C)ccn2)ccc1)c1c(-c2ccccc2)cccc1-c1ccccc1.[Pt] |
| InChI | InChI=1S/C65H50GeN5O.Pt/c1-65(2,3)45-37-38-67-61(39-45)71-59-36-20-31-53-62(59)63-54(66(53)51-29-12-15-33-56(51)69(4)57-34-16-13-30-52(57)66)41-48(42-60(63)71)72-47-26-18-25-46(40-47)68-55-32-14-17-35-58(55)70(5)64-49(43-21-8-6-9-22-43)27-19-28-50(64)44-23-10-7-11-24-44;/h6-39,41,68H,5H2,1-4H3;/q-3; |
| InChIKey | VHPJLRORMVKHKE-UHFFFAOYSA-N |
| XLogP | 13.65 |
| TPSA | 45.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 73 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1184.84 |
| LogP ≤ 5 | 13.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|