C77H71N4OPtS-3 — CID 176843824
CID 176843824 (PubChem CID 176843824) has the molecular formula C77H71N4OPtS-3 and a molecular weight of 1295.59 g/mol.
| Compound Name | CID 176843824 |
|---|---|
| PubChem CID | 176843824 |
| Molecular Formula | C77H71N4OPtS-3 |
| Molecular Weight | 1295.59 g/mol |
| Exact Mass | 1294.50 |
| IUPAC Name | — |
| SMILES | [CH2-]N(c1ccccc1Nc1[c-]c(Oc2[c-]c3c4c(c2)C2(c5ccccc5Sc5ccccc52)c2cccc(c24)n3-c2cc(C(C)(C)C)ccn2)ccc1)c1c(-c2ccccc2)cc(C(C)(C)C)cc1-c1cc(C(C)(C)C)cc(C(C)(C)C)c1.[Pt] |
| InChI | InChI=1S/C77H71N4OS.Pt/c1-73(2,3)50-37-38-78-69(44-50)81-65-34-24-31-61-70(65)71-62(77(61)59-29-17-21-35-67(59)83-68-36-22-18-30-60(68)77)46-56(47-66(71)81)82-55-28-23-27-54(45-55)79-63-32-19-20-33-64(63)80(13)72-57(48-25-15-14-16-26-48)42-53(76(10,11)12)43-58(72)49-39-51(74(4,5)6)41-52(40-49)75(7,8)9;/h14-44,46,79H,13H2,1-12H3;/q-3; |
| InChIKey | ZDBFXVYVELIOHB-UHFFFAOYSA-N |
| XLogP | 20.93 |
| TPSA | 42.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 84 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1295.59 |
| LogP ≤ 5 | 20.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|