C45H33N3OPtSi — CID 176845142
CID 176845142 (PubChem CID 176845142) has the molecular formula C45H33N3OPtSi and a molecular weight of 854.94 g/mol.
| Compound Name | CID 176845142 |
|---|---|
| PubChem CID | 176845142 |
| Molecular Formula | C45H33N3OPtSi |
| Molecular Weight | 854.94 g/mol |
| Exact Mass | 854.20 |
| IUPAC Name | — |
| SMILES | C[Si](C)(C)c1cc[c-]c(-c2cccc(Oc3ccc4c5ccccc5n(-c5[c-]cc6c(c5)C5c7ccccc7C6c6ccccc65)c4n3)n2)c1.[Pt+2] |
| InChI | InChI=1S/C45H33N3OSi.Pt/c1-50(2,3)30-13-10-12-28(26-30)39-19-11-21-41(46-39)49-42-25-24-37-31-14-8-9-20-40(31)48(45(37)47-42)29-22-23-36-38(27-29)44-34-17-6-4-15-32(34)43(36)33-16-5-7-18-35(33)44;/h4-11,13-21,23-27,43-44H,1-3H3;/q-2;+2 |
| InChIKey | OAFBMIIPPFUFIJ-UHFFFAOYSA-N |
| XLogP | 10.16 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 854.94 |
| LogP ≤ 5 | 10.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|