C23H21Cl2FN2O4 — CID 176846924
N-[[3,5-dichloro-4-(2,6-dioxopiperidin-3-yl)phenyl]methyl]-3-(4-fluorophenyl)oxolane-3-carboxamide (PubChem CID 176846924) has the molecular formula C23H21Cl2FN2O4 and a molecular weight of 479.34 g/mol. Its IUPAC name is N-[[3,5-dichloro-4-(2,6-dioxopiperidin-3-yl)phenyl]methyl]-3-(4-fluorophenyl)oxolane-3-carboxamide.
| Compound Name | N-[[3,5-dichloro-4-(2,6-dioxopiperidin-3-yl)phenyl]methyl]-3-(4-fluorophenyl)oxolane-3-carboxamide |
|---|---|
| PubChem CID | 176846924 |
| Molecular Formula | C23H21Cl2FN2O4 |
| Molecular Weight | 479.34 g/mol |
| Exact Mass | 478.09 |
| IUPAC Name | N-[[3,5-dichloro-4-(2,6-dioxopiperidin-3-yl)phenyl]methyl]-3-(4-fluorophenyl)oxolane-3-carboxamide |
| SMILES | O=C1CCC(c2c(Cl)cc(CNC(=O)C3(c4ccc(F)cc4)CCOC3)cc2Cl)C(=O)N1 |
| InChI | InChI=1S/C23H21Cl2FN2O4/c24-17-9-13(10-18(25)20(17)16-5-6-19(29)28-21(16)30)11-27-22(31)23(7-8-32-12-23)14-1-3-15(26)4-2-14/h1-4,9-10,16H,5-8,11-12H2,(H,27,31)(H,28,29,30) |
| InChIKey | QZSRFRCRCBTIHK-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.34 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|