C20H19Cl2FN4O3 — CID 176846759
N-[[3,5-dichloro-4-(2,6-dioxopiperidin-3-yl)phenyl]methyl]-2-(5-fluoropyrimidin-2-yl)-2-methylpropanamide (PubChem CID 176846759) has the molecular formula C20H19Cl2FN4O3 and a molecular weight of 453.30 g/mol. Its IUPAC name is N-[[3,5-dichloro-4-(2,6-dioxopiperidin-3-yl)phenyl]methyl]-2-(5-fluoropyrimidin-2-yl)-2-methylpropanamide.
| Compound Name | N-[[3,5-dichloro-4-(2,6-dioxopiperidin-3-yl)phenyl]methyl]-2-(5-fluoropyrimidin-2-yl)-2-methylpropanamide |
|---|---|
| PubChem CID | 176846759 |
| Molecular Formula | C20H19Cl2FN4O3 |
| Molecular Weight | 453.30 g/mol |
| Exact Mass | 452.08 |
| IUPAC Name | N-[[3,5-dichloro-4-(2,6-dioxopiperidin-3-yl)phenyl]methyl]-2-(5-fluoropyrimidin-2-yl)-2-methylpropanamide |
| SMILES | CC(C)(C(=O)NCc1cc(Cl)c(C2CCC(=O)NC2=O)c(Cl)c1)c1ncc(F)cn1 |
| InChI | InChI=1S/C20H19Cl2FN4O3/c1-20(2,18-24-8-11(23)9-25-18)19(30)26-7-10-5-13(21)16(14(22)6-10)12-3-4-15(28)27-17(12)29/h5-6,8-9,12H,3-4,7H2,1-2H3,(H,26,30)(H,27,28,29) |
| InChIKey | LFSWKBNXONLSKK-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 101.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.30 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|