C23H25Cl2N3O4 — CID 176846777
N-[[3,5-dichloro-4-(2,6-dioxopiperidin-3-yl)phenyl]methyl]-2-(1-ethyl-2-oxo-4-pyridinyl)-2-methylpropanamide (PubChem CID 176846777) has the molecular formula C23H25Cl2N3O4 and a molecular weight of 478.38 g/mol. Its IUPAC name is N-[[3,5-dichloro-4-(2,6-dioxopiperidin-3-yl)phenyl]methyl]-2-(1-ethyl-2-oxo-4-pyridinyl)-2-methylpropanamide.
| Compound Name | N-[[3,5-dichloro-4-(2,6-dioxopiperidin-3-yl)phenyl]methyl]-2-(1-ethyl-2-oxo-4-pyridinyl)-2-methylpropanamide |
|---|---|
| PubChem CID | 176846777 |
| Molecular Formula | C23H25Cl2N3O4 |
| Molecular Weight | 478.38 g/mol |
| Exact Mass | 477.12 |
| IUPAC Name | N-[[3,5-dichloro-4-(2,6-dioxopiperidin-3-yl)phenyl]methyl]-2-(1-ethyl-2-oxo-4-pyridinyl)-2-methylpropanamide |
| SMILES | CCn1ccc(C(C)(C)C(=O)NCc2cc(Cl)c(C3CCC(=O)NC3=O)c(Cl)c2)cc1=O |
| InChI | InChI=1S/C23H25Cl2N3O4/c1-4-28-8-7-14(11-19(28)30)23(2,3)22(32)26-12-13-9-16(24)20(17(25)10-13)15-5-6-18(29)27-21(15)31/h7-11,15H,4-6,12H2,1-3H3,(H,26,32)(H,27,29,31) |
| InChIKey | WSPRHPHRUAUMEV-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 97.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.38 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|