C21H17IrN2- — CID 176849300
iridium;5-(5-isocyano-2-methylphenyl)-3,4-dimethyl-2-phenylpyridine (PubChem CID 176849300) has the molecular formula C21H17IrN2- and a molecular weight of 489.60 g/mol. Its IUPAC name is iridium;5-(5-isocyano-2-methylphenyl)-3,4-dimethyl-2-phenylpyridine.
| Compound Name | iridium;5-(5-isocyano-2-methylphenyl)-3,4-dimethyl-2-phenylpyridine |
|---|---|
| PubChem CID | 176849300 |
| Molecular Formula | C21H17IrN2- |
| Molecular Weight | 489.60 g/mol |
| Exact Mass | 490.10 |
| IUPAC Name | iridium;5-(5-isocyano-2-methylphenyl)-3,4-dimethyl-2-phenylpyridine |
| SMILES | [C-]#[N+]c1ccc(C)c(-c2cnc(-c3[c-]cccc3)c(C)c2C)c1.[Ir] |
| InChI | InChI=1S/C21H17N2.Ir/c1-14-10-11-18(22-4)12-19(14)20-13-23-21(16(3)15(20)2)17-8-6-5-7-9-17;/h5-8,10-13H,1-3H3;/q-1; |
| InChIKey | ABKCYUSIGFGCAH-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 17.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.60 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|