C28H42S4 — CID 176857386
7-[bis(hexylsulfanyl)methylidene]-4,10-di(propan-2-yl)-3,11-dithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraene (PubChem CID 176857386) has the molecular formula C28H42S4 and a molecular weight of 506.91 g/mol. Its IUPAC name is 7-[bis(hexylsulfanyl)methylidene]-4,10-di(propan-2-yl)-3,11-dithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraene.
| Compound Name | 7-[bis(hexylsulfanyl)methylidene]-4,10-di(propan-2-yl)-3,11-dithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraene |
|---|---|
| PubChem CID | 176857386 |
| Molecular Formula | C28H42S4 |
| Molecular Weight | 506.91 g/mol |
| Exact Mass | 506.22 |
| IUPAC Name | 7-[bis(hexylsulfanyl)methylidene]-4,10-di(propan-2-yl)-3,11-dithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraene |
| SMILES | CCCCCCSC(SCCCCCC)=C1c2cc(C(C)C)sc2-c2sc(C(C)C)cc21 |
| InChI | InChI=1S/C28H42S4/c1-7-9-11-13-15-29-28(30-16-14-12-10-8-2)25-21-17-23(19(3)4)31-26(21)27-22(25)18-24(32-27)20(5)6/h17-20H,7-16H2,1-6H3 |
| InChIKey | FQYUTSGVJBYQII-UHFFFAOYSA-N |
| XLogP | 11.38 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.91 |
| LogP ≤ 5 | 11.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|