C49H32N5Pt-3 — CID 176871673
2-[2,2-diphenyl-1-[4-(3-phenyl-2H-benzimidazol-2-id-1-yl)-3H-pyridin-3-id-2-yl]ethenyl]-9-pyridin-2-yl-1H-carbazol-1-ide;platinum (PubChem CID 176871673) has the molecular formula C49H32N5Pt-3 and a molecular weight of 885.91 g/mol. Its IUPAC name is 2-[2,2-diphenyl-1-[4-(3-phenyl-2H-benzimidazol-2-id-1-yl)-3H-pyridin-3-id-2-yl]ethenyl]-9-pyridin-2-yl-1H-carbazol-1-ide;platinum.
| Compound Name | 2-[2,2-diphenyl-1-[4-(3-phenyl-2H-benzimidazol-2-id-1-yl)-3H-pyridin-3-id-2-yl]ethenyl]-9-pyridin-2-yl-1H-carbazol-1-ide;platinum |
|---|---|
| PubChem CID | 176871673 |
| Molecular Formula | C49H32N5Pt-3 |
| Molecular Weight | 885.91 g/mol |
| Exact Mass | 885.23 |
| IUPAC Name | 2-[2,2-diphenyl-1-[4-(3-phenyl-2H-benzimidazol-2-id-1-yl)-3H-pyridin-3-id-2-yl]ethenyl]-9-pyridin-2-yl-1H-carbazol-1-ide;platinum |
| SMILES | [Pt].[c-]1c(N2[CH-]N(c3ccccc3)c3ccccc32)ccnc1C(=C(c1ccccc1)c1ccccc1)c1[c-]c2c(cc1)c1ccccc1n2-c1ccccn1 |
| InChI | InChI=1S/C49H32N5.Pt/c1-4-16-35(17-5-1)48(36-18-6-2-7-19-36)49(37-27-28-41-40-22-10-11-23-43(40)54(46(41)32-37)47-26-14-15-30-51-47)42-33-39(29-31-50-42)53-34-52(38-20-8-3-9-21-38)44-24-12-13-25-45(44)53;/h1-31,34H;/q-3; |
| InChIKey | KNAVJJHCGDZQFU-UHFFFAOYSA-N |
| XLogP | 11.59 |
| TPSA | 37.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 885.91 |
| LogP ≤ 5 | 11.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|