C60H49N4Pt-3 — CID 176871655
2-[2,2-bis(4-cyclopentylphenyl)-1-[3-(3-phenyl-2H-benzimidazol-2-id-1-yl)benzene-2-id-1-yl]ethenyl]-9-pyridin-2-yl-1H-carbazol-1-ide;platinum (PubChem CID 176871655) has the molecular formula C60H49N4Pt-3 and a molecular weight of 1021.16 g/mol. Its IUPAC name is 2-[2,2-bis(4-cyclopentylphenyl)-1-[3-(3-phenyl-2H-benzimidazol-2-id-1-yl)benzene-2-id-1-yl]ethenyl]-9-pyridin-2-yl-1H-carbazol-1-ide;platinum.
| Compound Name | 2-[2,2-bis(4-cyclopentylphenyl)-1-[3-(3-phenyl-2H-benzimidazol-2-id-1-yl)benzene-2-id-1-yl]ethenyl]-9-pyridin-2-yl-1H-carbazol-1-ide;platinum |
|---|---|
| PubChem CID | 176871655 |
| Molecular Formula | C60H49N4Pt-3 |
| Molecular Weight | 1021.16 g/mol |
| Exact Mass | 1020.36 |
| IUPAC Name | 2-[2,2-bis(4-cyclopentylphenyl)-1-[3-(3-phenyl-2H-benzimidazol-2-id-1-yl)benzene-2-id-1-yl]ethenyl]-9-pyridin-2-yl-1H-carbazol-1-ide;platinum |
| SMILES | [Pt].[c-]1c(C(=C(c2ccc(C3CCCC3)cc2)c2ccc(C3CCCC3)cc2)c2[c-]c3c(cc2)c2ccccc2n3-c2ccccn2)cccc1N1[CH-]N(c2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C60H49N4.Pt/c1-2-20-50(21-3-1)62-41-63(56-26-11-10-25-55(56)62)51-22-14-19-48(39-51)60(49-36-37-53-52-23-8-9-24-54(52)64(57(53)40-49)58-27-12-13-38-61-58)59(46-32-28-44(29-33-46)42-15-4-5-16-42)47-34-30-45(31-35-47)43-17-6-7-18-43;/h1-3,8-14,19-38,41-43H,4-7,15-18H2;/q-3; |
| InChIKey | HUMLRNWPOABYHE-UHFFFAOYSA-N |
| XLogP | 15.51 |
| TPSA | 24.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1021.16 |
| LogP ≤ 5 | 15.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|