C48H31N4PtS-3 — CID 176871714
6-[2,2-diphenyl-1-[3-(3-phenyl-2H-benzimidazol-2-id-1-yl)benzene-2-id-1-yl]ethenyl]-4-pyridin-2-yl-5H-thieno[2,3-b]indol-5-ide;platinum (PubChem CID 176871714) has the molecular formula C48H31N4PtS-3 and a molecular weight of 890.95 g/mol. Its IUPAC name is 6-[2,2-diphenyl-1-[3-(3-phenyl-2H-benzimidazol-2-id-1-yl)benzene-2-id-1-yl]ethenyl]-4-pyridin-2-yl-5H-thieno[2,3-b]indol-5-ide;platinum.
| Compound Name | 6-[2,2-diphenyl-1-[3-(3-phenyl-2H-benzimidazol-2-id-1-yl)benzene-2-id-1-yl]ethenyl]-4-pyridin-2-yl-5H-thieno[2,3-b]indol-5-ide;platinum |
|---|---|
| PubChem CID | 176871714 |
| Molecular Formula | C48H31N4PtS-3 |
| Molecular Weight | 890.95 g/mol |
| Exact Mass | 890.19 |
| IUPAC Name | 6-[2,2-diphenyl-1-[3-(3-phenyl-2H-benzimidazol-2-id-1-yl)benzene-2-id-1-yl]ethenyl]-4-pyridin-2-yl-5H-thieno[2,3-b]indol-5-ide;platinum |
| SMILES | [Pt].[c-]1c(C(=C(c2ccccc2)c2ccccc2)c2[c-]c3c(cc2)c2ccsc2n3-c2ccccn2)cccc1N1[CH-]N(c2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C48H31N4S.Pt/c1-4-15-34(16-5-1)46(35-17-6-2-7-18-35)47(37-26-27-40-41-28-30-53-48(41)52(44(40)32-37)45-25-12-13-29-49-45)36-19-14-22-39(31-36)51-33-50(38-20-8-3-9-21-38)42-23-10-11-24-43(42)51;/h1-30,33H;/q-3; |
| InChIKey | CWBGHBQIDVSEAF-UHFFFAOYSA-N |
| XLogP | 12.25 |
| TPSA | 24.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 890.95 |
| LogP ≤ 5 | 12.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|