C28H26O5S — CID 176879877
4-(15-methyltetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15-carbonyl)oxy-5,6,7,8-tetrahydronaphthalene-1-sulfonic acid (PubChem CID 176879877) has the molecular formula C28H26O5S and a molecular weight of 474.58 g/mol. Its IUPAC name is 4-(15-methyltetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15-carbonyl)oxy-5,6,7,8-tetrahydronaphthalene-1-sulfonic acid.
| Compound Name | 4-(15-methyltetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15-carbonyl)oxy-5,6,7,8-tetrahydronaphthalene-1-sulfonic acid |
|---|---|
| PubChem CID | 176879877 |
| Molecular Formula | C28H26O5S |
| Molecular Weight | 474.58 g/mol |
| Exact Mass | 474.15 |
| IUPAC Name | 4-(15-methyltetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15-carbonyl)oxy-5,6,7,8-tetrahydronaphthalene-1-sulfonic acid |
| SMILES | CC1(C(=O)Oc2ccc(S(=O)(=O)O)c3c2CCCC3)CC2c3ccccc3C1c1ccccc12 |
| InChI | InChI=1S/C28H26O5S/c1-28(16-23-17-8-2-6-12-21(17)26(28)22-13-7-3-9-18(22)23)27(29)33-24-14-15-25(34(30,31)32)20-11-5-4-10-19(20)24/h2-3,6-9,12-15,23,26H,4-5,10-11,16H2,1H3,(H,30,31,32) |
| InChIKey | TUJQSBHQKUUOOF-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.58 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|