C11H12Cl2N2O2 — CID 176881809
(2,6-dichloro-4-pyridinyl)methyl 2-[(1S,2S)-2-aminocyclopropyl]acetate (PubChem CID 176881809) has the molecular formula C11H12Cl2N2O2 and a molecular weight of 275.13 g/mol. Its IUPAC name is (2,6-dichloro-4-pyridinyl)methyl 2-[(1S,2S)-2-aminocyclopropyl]acetate.
| Compound Name | (2,6-dichloro-4-pyridinyl)methyl 2-[(1S,2S)-2-aminocyclopropyl]acetate |
|---|---|
| PubChem CID | 176881809 |
| Molecular Formula | C11H12Cl2N2O2 |
| Molecular Weight | 275.13 g/mol |
| Exact Mass | 274.03 |
| IUPAC Name | (2,6-dichloro-4-pyridinyl)methyl 2-[(1S,2S)-2-aminocyclopropyl]acetate |
| SMILES | N[C@H]1C[C@H]1CC(=O)OCc1cc(Cl)nc(Cl)c1 |
| InChI | InChI=1S/C11H12Cl2N2O2/c12-9-1-6(2-10(13)15-9)5-17-11(16)4-7-3-8(7)14/h1-2,7-8H,3-5,14H2/t7-,8-/m0/s1 |
| InChIKey | BRZSGSKFPCAZHN-YUMQZZPRSA-N |
| XLogP | 2.17 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.13 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|