C16H12ClN3OS — CID 176887965
2-chloro-4-methoxy-6-(4-phenylsulfanylphenyl)-1,3,5-triazine (PubChem CID 176887965) has the molecular formula C16H12ClN3OS and a molecular weight of 329.81 g/mol. Its IUPAC name is 2-chloro-4-methoxy-6-(4-phenylsulfanylphenyl)-1,3,5-triazine.
| Compound Name | 2-chloro-4-methoxy-6-(4-phenylsulfanylphenyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 176887965 |
| Molecular Formula | C16H12ClN3OS |
| Molecular Weight | 329.81 g/mol |
| Exact Mass | 329.04 |
| IUPAC Name | 2-chloro-4-methoxy-6-(4-phenylsulfanylphenyl)-1,3,5-triazine |
| SMILES | COc1nc(Cl)nc(-c2ccc(Sc3ccccc3)cc2)n1 |
| InChI | InChI=1S/C16H12ClN3OS/c1-21-16-19-14(18-15(17)20-16)11-7-9-13(10-8-11)22-12-5-3-2-4-6-12/h2-10H,1H3 |
| InChIKey | NZOINQHKGVFLNJ-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 47.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.81 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |