C24H27N3O4 — CID 176892863
4-[4-[6-[2-(benzylamino)-2-hydroxyethyl]-3-pyridinyl]phenoxy]-N-hydroxybutanamide (PubChem CID 176892863) has the molecular formula C24H27N3O4 and a molecular weight of 421.50 g/mol. Its IUPAC name is 4-[4-[6-[2-(benzylamino)-2-hydroxyethyl]-3-pyridinyl]phenoxy]-N-hydroxybutanamide.
| Compound Name | 4-[4-[6-[2-(benzylamino)-2-hydroxyethyl]-3-pyridinyl]phenoxy]-N-hydroxybutanamide |
|---|---|
| PubChem CID | 176892863 |
| Molecular Formula | C24H27N3O4 |
| Molecular Weight | 421.50 g/mol |
| Exact Mass | 421.20 |
| IUPAC Name | 4-[4-[6-[2-(benzylamino)-2-hydroxyethyl]-3-pyridinyl]phenoxy]-N-hydroxybutanamide |
| SMILES | O=C(CCCOc1ccc(-c2ccc(CC(O)NCc3ccccc3)nc2)cc1)NO |
| InChI | InChI=1S/C24H27N3O4/c28-23(27-30)7-4-14-31-22-12-9-19(10-13-22)20-8-11-21(25-17-20)15-24(29)26-16-18-5-2-1-3-6-18/h1-3,5-6,8-13,17,24,26,29-30H,4,7,14-16H2,(H,27,28) |
| InChIKey | YOMJBCQQSBUFGR-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 103.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.50 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|