C16H17N3OS2 — CID 176898306
6-butylsulfinyl-2-phenylthieno[2,3-b]pyrazin-7-amine (PubChem CID 176898306) has the molecular formula C16H17N3OS2 and a molecular weight of 331.47 g/mol. Its IUPAC name is 6-butylsulfinyl-2-phenylthieno[2,3-b]pyrazin-7-amine.
| Compound Name | 6-butylsulfinyl-2-phenylthieno[2,3-b]pyrazin-7-amine |
|---|---|
| PubChem CID | 176898306 |
| Molecular Formula | C16H17N3OS2 |
| Molecular Weight | 331.47 g/mol |
| Exact Mass | 331.08 |
| IUPAC Name | 6-butylsulfinyl-2-phenylthieno[2,3-b]pyrazin-7-amine |
| SMILES | CCCCS(=O)c1sc2ncc(-c3ccccc3)nc2c1N |
| InChI | InChI=1S/C16H17N3OS2/c1-2-3-9-22(20)16-13(17)14-15(21-16)18-10-12(19-14)11-7-5-4-6-8-11/h4-8,10H,2-3,9,17H2,1H3 |
| InChIKey | KYXLTDHDHJYQJF-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 68.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.47 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |