C18H18N4OS2 — CID 176898332
11-butylsulfinyl-7-phenyl-12-thia-3,6,8-triazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,10-pentaen-10-amine (PubChem CID 176898332) has the molecular formula C18H18N4OS2 and a molecular weight of 370.50 g/mol. Its IUPAC name is 11-butylsulfinyl-7-phenyl-12-thia-3,6,8-triazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,10-pentaen-10-amine.
| Compound Name | 11-butylsulfinyl-7-phenyl-12-thia-3,6,8-triazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,10-pentaen-10-amine |
|---|---|
| PubChem CID | 176898332 |
| Molecular Formula | C18H18N4OS2 |
| Molecular Weight | 370.50 g/mol |
| Exact Mass | 370.09 |
| IUPAC Name | 11-butylsulfinyl-7-phenyl-12-thia-3,6,8-triazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,10-pentaen-10-amine |
| SMILES | CCCCS(=O)c1sc2c(nc(-c3ccccc3)n3ccnc23)c1N |
| InChI | InChI=1S/C18H18N4OS2/c1-2-3-11-25(23)18-13(19)14-15(24-18)17-20-9-10-22(17)16(21-14)12-7-5-4-6-8-12/h4-10H,2-3,11,19H2,1H3 |
| InChIKey | AMLXOLAVJSWNAR-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 73.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.50 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |