C12H18O4 — CID 176902312
3-ethyldecane-2,4,6,7-tetrone (PubChem CID 176902312) has the molecular formula C12H18O4 and a molecular weight of 226.27 g/mol. Its IUPAC name is 3-ethyldecane-2,4,6,7-tetrone.
| Compound Name | 3-ethyldecane-2,4,6,7-tetrone |
|---|---|
| PubChem CID | 176902312 |
| Molecular Formula | C12H18O4 |
| Molecular Weight | 226.27 g/mol |
| Exact Mass | 226.12 |
| IUPAC Name | 3-ethyldecane-2,4,6,7-tetrone |
| SMILES | CCCC(=O)C(=O)CC(=O)C(CC)C(C)=O |
| InChI | InChI=1S/C12H18O4/c1-4-6-10(14)12(16)7-11(15)9(5-2)8(3)13/h9H,4-7H2,1-3H3 |
| InChIKey | BJMCJZYZPUILNY-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.27 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|