About 3-ethyldecane-2,4,6,7-tetrone
3-ethyldecane-2,4,6,7-tetrone (PubChem CID 176902312) has the molecular formula C12H18O4
and a molecular weight of 226.27 g/mol. Its IUPAC name is 3-ethyldecane-2,4,6,7-tetrone.
Molecular Properties
| Compound Name | 3-ethyldecane-2,4,6,7-tetrone |
| PubChem CID | 176902312 |
| Molecular Formula | C12H18O4 |
| Molecular Weight | 226.27 g/mol |
| Exact Mass | 226.12 |
| IUPAC Name | 3-ethyldecane-2,4,6,7-tetrone |
| SMILES | CCCC(=O)C(=O)CC(=O)C(CC)C(C)=O |
| InChI | InChI=1S/C12H18O4/c1-4-6-10(14)12(16)7-11(15)9(5-2)8(3)13/h9H,4-7H2,1-3H3 |
| InChIKey | BJMCJZYZPUILNY-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.27 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 3-ethyldecane-2,4,6,7-tetrone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyldecane-2,4,6,7-tetrone?
The IUPAC name of 3-ethyldecane-2,4,6,7-tetrone (CID 176902312) is 3-ethyldecane-2,4,6,7-tetrone.
What is the SMILES notation for 3-ethyldecane-2,4,6,7-tetrone?
The canonical SMILES for 3-ethyldecane-2,4,6,7-tetrone is CCCC(=O)C(=O)CC(=O)C(CC)C(C)=O.
What is the InChIKey of 3-ethyldecane-2,4,6,7-tetrone?
The InChIKey is BJMCJZYZPUILNY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18O4/c1-4-6-10(14)12(16)7-11(15)9(5-2)8(3)13/h9H,4-7H2,1-3H3.
What are the key properties of 3-ethyldecane-2,4,6,7-tetrone?
3-ethyldecane-2,4,6,7-tetrone has a molecular weight of 226.27 g/mol, XLogP of 1.50, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyldecane-2,4,6,7-tetrone is sourced from PubChem (CID 176902312), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).