C15H24O7 — CID 176908538
2-[2-(2-prop-2-enoyloxyethoxy)ethoxy]ethyl 4-(oxiran-2-yl)butanoate (PubChem CID 176908538) has the molecular formula C15H24O7 and a molecular weight of 316.35 g/mol. Its IUPAC name is 2-[2-(2-prop-2-enoyloxyethoxy)ethoxy]ethyl 4-(oxiran-2-yl)butanoate.
| Compound Name | 2-[2-(2-prop-2-enoyloxyethoxy)ethoxy]ethyl 4-(oxiran-2-yl)butanoate |
|---|---|
| PubChem CID | 176908538 |
| Molecular Formula | C15H24O7 |
| Molecular Weight | 316.35 g/mol |
| Exact Mass | 316.15 |
| IUPAC Name | 2-[2-(2-prop-2-enoyloxyethoxy)ethoxy]ethyl 4-(oxiran-2-yl)butanoate |
| SMILES | C=CC(=O)OCCOCCOCCOC(=O)CCCC1CO1 |
| InChI | InChI=1S/C15H24O7/c1-2-14(16)20-10-8-18-6-7-19-9-11-21-15(17)5-3-4-13-12-22-13/h2,13H,1,3-12H2 |
| InChIKey | CYSHODHUUULVAY-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 83.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.35 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|