C25H24FN3O3 — CID 176908869
1-N'-[2-[3-(dimethylamino)phenoxy]phenyl]-1-N'-(4-fluorophenyl)cyclopropane-1,1-dicarboxamide (PubChem CID 176908869) has the molecular formula C25H24FN3O3 and a molecular weight of 433.48 g/mol. Its IUPAC name is 1-N'-[2-[3-(dimethylamino)phenoxy]phenyl]-1-N'-(4-fluorophenyl)cyclopropane-1,1-dicarboxamide.
| Compound Name | 1-N'-[2-[3-(dimethylamino)phenoxy]phenyl]-1-N'-(4-fluorophenyl)cyclopropane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 176908869 |
| Molecular Formula | C25H24FN3O3 |
| Molecular Weight | 433.48 g/mol |
| Exact Mass | 433.18 |
| IUPAC Name | 1-N'-[2-[3-(dimethylamino)phenoxy]phenyl]-1-N'-(4-fluorophenyl)cyclopropane-1,1-dicarboxamide |
| SMILES | CN(C)c1cccc(Oc2ccccc2N(C(=O)C2(C(N)=O)CC2)c2ccc(F)cc2)c1 |
| InChI | InChI=1S/C25H24FN3O3/c1-28(2)19-6-5-7-20(16-19)32-22-9-4-3-8-21(22)29(18-12-10-17(26)11-13-18)24(31)25(14-15-25)23(27)30/h3-13,16H,14-15H2,1-2H3,(H2,27,30) |
| InChIKey | COSPTTLDXCYGPB-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 75.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.48 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|