C27H29N3O5 — CID 176908879
1-N'-(3,4-dimethoxyphenyl)-1-N'-[2-[3-(dimethylamino)phenoxy]phenyl]cyclopropane-1,1-dicarboxamide (PubChem CID 176908879) has the molecular formula C27H29N3O5 and a molecular weight of 475.55 g/mol. Its IUPAC name is 1-N'-(3,4-dimethoxyphenyl)-1-N'-[2-[3-(dimethylamino)phenoxy]phenyl]cyclopropane-1,1-dicarboxamide.
| Compound Name | 1-N'-(3,4-dimethoxyphenyl)-1-N'-[2-[3-(dimethylamino)phenoxy]phenyl]cyclopropane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 176908879 |
| Molecular Formula | C27H29N3O5 |
| Molecular Weight | 475.55 g/mol |
| Exact Mass | 475.21 |
| IUPAC Name | 1-N'-(3,4-dimethoxyphenyl)-1-N'-[2-[3-(dimethylamino)phenoxy]phenyl]cyclopropane-1,1-dicarboxamide |
| SMILES | COc1ccc(N(C(=O)C2(C(N)=O)CC2)c2ccccc2Oc2cccc(N(C)C)c2)cc1OC |
| InChI | InChI=1S/C27H29N3O5/c1-29(2)18-8-7-9-20(16-18)35-22-11-6-5-10-21(22)30(26(32)27(14-15-27)25(28)31)19-12-13-23(33-3)24(17-19)34-4/h5-13,16-17H,14-15H2,1-4H3,(H2,28,31) |
| InChIKey | IKQKMKAEHNTZFH-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 94.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.55 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|