C33H34N4O6 — CID 66669399
1-N'-[4-(6,7-dimethoxyquinolin-4-yl)oxyphenyl]-1-N'-[3-(morpholin-4-ylmethyl)phenyl]cyclopropane-1,1-dicarboxamide (PubChem CID 66669399) has the molecular formula C33H34N4O6 and a molecular weight of 582.66 g/mol. Its IUPAC name is 1-N'-[4-(6,7-dimethoxyquinolin-4-yl)oxyphenyl]-1-N'-[3-(morpholin-4-ylmethyl)phenyl]cyclopropane-1,1-dicarboxamide.
| Compound Name | 1-N'-[4-(6,7-dimethoxyquinolin-4-yl)oxyphenyl]-1-N'-[3-(morpholin-4-ylmethyl)phenyl]cyclopropane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 66669399 |
| Molecular Formula | C33H34N4O6 |
| Molecular Weight | 582.66 g/mol |
| Exact Mass | 582.25 |
| IUPAC Name | 1-N'-[4-(6,7-dimethoxyquinolin-4-yl)oxyphenyl]-1-N'-[3-(morpholin-4-ylmethyl)phenyl]cyclopropane-1,1-dicarboxamide |
| SMILES | COc1cc2nccc(Oc3ccc(N(C(=O)C4(C(N)=O)CC4)c4cccc(CN5CCOCC5)c4)cc3)c2cc1OC |
| InChI | InChI=1S/C33H34N4O6/c1-40-29-19-26-27(20-30(29)41-2)35-13-10-28(26)43-25-8-6-23(7-9-25)37(32(39)33(11-12-33)31(34)38)24-5-3-4-22(18-24)21-36-14-16-42-17-15-36/h3-10,13,18-20H,11-12,14-17,21H2,1-2H3,(H2,34,38) |
| InChIKey | JSPJVEUARDTUSH-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 116.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.66 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|