C23H26ClFN2O — CID 176909787
(2E)-6-(4-ethylpiperazin-1-yl)-2-[(2-fluorophenyl)methylidene]-3,4-dihydronaphthalen-1-one;hydrochloride (PubChem CID 176909787) has the molecular formula C23H26ClFN2O and a molecular weight of 400.93 g/mol. Its IUPAC name is (2E)-6-(4-ethylpiperazin-1-yl)-2-[(2-fluorophenyl)methylidene]-3,4-dihydronaphthalen-1-one;hydrochloride.
| Compound Name | (2E)-6-(4-ethylpiperazin-1-yl)-2-[(2-fluorophenyl)methylidene]-3,4-dihydronaphthalen-1-one;hydrochloride |
|---|---|
| PubChem CID | 176909787 |
| Molecular Formula | C23H26ClFN2O |
| Molecular Weight | 400.93 g/mol |
| Exact Mass | 400.17 |
| IUPAC Name | (2E)-6-(4-ethylpiperazin-1-yl)-2-[(2-fluorophenyl)methylidene]-3,4-dihydronaphthalen-1-one;hydrochloride |
| SMILES | CCN1CCN(c2ccc3c(c2)CC/C(=C\c2ccccc2F)C3=O)CC1.Cl |
| InChI | InChI=1S/C23H25FN2O.ClH/c1-2-25-11-13-26(14-12-25)20-9-10-21-17(16-20)7-8-19(23(21)27)15-18-5-3-4-6-22(18)24;/h3-6,9-10,15-16H,2,7-8,11-14H2,1H3;1H/b19-15+; |
| InChIKey | AJGZBXKWNNHSSJ-QTCZRQAZSA-N |
| XLogP | 4.60 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.93 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|