C22H37N — CID 176916059
N,N-dihexyl-5,6,7,8-tetrahydronaphthalen-1-amine (PubChem CID 176916059) has the molecular formula C22H37N and a molecular weight of 315.55 g/mol. Its IUPAC name is N,N-dihexyl-5,6,7,8-tetrahydronaphthalen-1-amine.
| Compound Name | N,N-dihexyl-5,6,7,8-tetrahydronaphthalen-1-amine |
|---|---|
| PubChem CID | 176916059 |
| Molecular Formula | C22H37N |
| Molecular Weight | 315.55 g/mol |
| Exact Mass | 315.29 |
| IUPAC Name | N,N-dihexyl-5,6,7,8-tetrahydronaphthalen-1-amine |
| SMILES | CCCCCCN(CCCCCC)c1cccc2c1CCCC2 |
| InChI | InChI=1S/C22H37N/c1-3-5-7-11-18-23(19-12-8-6-4-2)22-17-13-15-20-14-9-10-16-21(20)22/h13,15,17H,3-12,14,16,18-19H2,1-2H3 |
| InChIKey | OFIRWRAHFIMJTQ-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.55 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|