C16H13F3O4S — CID 176917310
2-[1-hydroxy-1-(3,4,5-trifluorophenyl)ethyl]-1,1-dioxo-2,3-dihydro-1-benzothiophen-3-ol (PubChem CID 176917310) has the molecular formula C16H13F3O4S and a molecular weight of 358.34 g/mol. Its IUPAC name is 2-[1-hydroxy-1-(3,4,5-trifluorophenyl)ethyl]-1,1-dioxo-2,3-dihydro-1-benzothiophen-3-ol.
| Compound Name | 2-[1-hydroxy-1-(3,4,5-trifluorophenyl)ethyl]-1,1-dioxo-2,3-dihydro-1-benzothiophen-3-ol |
|---|---|
| PubChem CID | 176917310 |
| Molecular Formula | C16H13F3O4S |
| Molecular Weight | 358.34 g/mol |
| Exact Mass | 358.05 |
| IUPAC Name | 2-[1-hydroxy-1-(3,4,5-trifluorophenyl)ethyl]-1,1-dioxo-2,3-dihydro-1-benzothiophen-3-ol |
| SMILES | CC(O)(c1cc(F)c(F)c(F)c1)C1C(O)c2ccccc2S1(=O)=O |
| InChI | InChI=1S/C16H13F3O4S/c1-16(21,8-6-10(17)13(19)11(18)7-8)15-14(20)9-4-2-3-5-12(9)24(15,22)23/h2-7,14-15,20-21H,1H3 |
| InChIKey | FMMWDDUBWNATPH-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.34 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|