C17H23N3O2 — CID 176933495
5-ethyl-N,N-dimethyl-7-piperazin-1-yl-1-benzofuran-2-carboxamide (PubChem CID 176933495) has the molecular formula C17H23N3O2 and a molecular weight of 301.39 g/mol. Its IUPAC name is 5-ethyl-N,N-dimethyl-7-piperazin-1-yl-1-benzofuran-2-carboxamide.
| Compound Name | 5-ethyl-N,N-dimethyl-7-piperazin-1-yl-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 176933495 |
| Molecular Formula | C17H23N3O2 |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.18 |
| IUPAC Name | 5-ethyl-N,N-dimethyl-7-piperazin-1-yl-1-benzofuran-2-carboxamide |
| SMILES | CCc1cc(N2CCNCC2)c2oc(C(=O)N(C)C)cc2c1 |
| InChI | InChI=1S/C17H23N3O2/c1-4-12-9-13-11-15(17(21)19(2)3)22-16(13)14(10-12)20-7-5-18-6-8-20/h9-11,18H,4-8H2,1-3H3 |
| InChIKey | SPYBOUKDGYZBPT-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 48.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |