C11H16FN — CID 176936611
2-fluoro-N-[(3-methyl-4-methylidenecyclohexa-1,5-dien-1-yl)methyl]ethanamine (PubChem CID 176936611) has the molecular formula C11H16FN and a molecular weight of 181.25 g/mol. Its IUPAC name is 2-fluoro-N-[(3-methyl-4-methylidenecyclohexa-1,5-dien-1-yl)methyl]ethanamine.
| Compound Name | 2-fluoro-N-[(3-methyl-4-methylidenecyclohexa-1,5-dien-1-yl)methyl]ethanamine |
|---|---|
| PubChem CID | 176936611 |
| Molecular Formula | C11H16FN |
| Molecular Weight | 181.25 g/mol |
| Exact Mass | 181.13 |
| IUPAC Name | 2-fluoro-N-[(3-methyl-4-methylidenecyclohexa-1,5-dien-1-yl)methyl]ethanamine |
| SMILES | C=C1C=CC(CNCCF)=CC1C |
| InChI | InChI=1S/C11H16FN/c1-9-3-4-11(7-10(9)2)8-13-6-5-12/h3-4,7,10,13H,1,5-6,8H2,2H3 |
| InChIKey | VMYATNBQJBOSLS-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.25 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|