C31H34F3N6O2Si — CID 176945909
CID 176945909 (PubChem CID 176945909) has the molecular formula C31H34F3N6O2Si and a molecular weight of 607.73 g/mol.
| Compound Name | CID 176945909 |
|---|---|
| PubChem CID | 176945909 |
| Molecular Formula | C31H34F3N6O2Si |
| Molecular Weight | 607.73 g/mol |
| Exact Mass | 607.25 |
| IUPAC Name | — |
| SMILES | COc1cc(C(C)(C)C#N)ccc1NCC#Cc1cc(C(=O)N[C@]2([Si])CCN(C)C[C@@H]2C)c2ncn(CC(F)(F)F)c2c1 |
| InChI | InChI=1S/C31H34F3N6O2Si/c1-20-16-39(4)12-10-30(20,43)38-28(41)23-13-21(14-25-27(23)37-19-40(25)18-31(32,33)34)7-6-11-36-24-9-8-22(15-26(24)42-5)29(2,3)17-35/h8-9,13-15,19-20,36H,10-12,16,18H2,1-5H3,(H,38,41)/t20-,30-/m0/s1 |
| InChIKey | KXOVBDDRAVOPPN-WRGVRERRSA-N |
| XLogP | 4.44 |
| TPSA | 95.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.73 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|