C21H15BF4N4O5 — CID 176945969
CID 176945969 (PubChem CID 176945969) has the molecular formula C21H15BF4N4O5 and a molecular weight of 490.18 g/mol.
| Compound Name | CID 176945969 |
|---|---|
| PubChem CID | 176945969 |
| Molecular Formula | C21H15BF4N4O5 |
| Molecular Weight | 490.18 g/mol |
| Exact Mass | 490.11 |
| IUPAC Name | — |
| SMILES | [B]C(O)(O)Oc1cc(C=O)c(F)cc1NCC#Cc1cc(C(N)=O)c2ncn(CC(F)(F)F)c2c1 |
| InChI | InChI=1S/C21H15BF4N4O5/c22-21(33,34)35-17-6-12(8-31)14(23)7-15(17)28-3-1-2-11-4-13(19(27)32)18-16(5-11)30(10-29-18)9-20(24,25)26/h4-8,10,28,33-34H,3,9H2,(H2,27,32) |
| InChIKey | RFOYSJOWWUFIJF-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 139.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.18 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|