C33H38F3N6O3Si — CID 176945949
CID 176945949 (PubChem CID 176945949) has the molecular formula C33H38F3N6O3Si and a molecular weight of 651.79 g/mol.
| Compound Name | CID 176945949 |
|---|---|
| PubChem CID | 176945949 |
| Molecular Formula | C33H38F3N6O3Si |
| Molecular Weight | 651.79 g/mol |
| Exact Mass | 651.27 |
| IUPAC Name | — |
| SMILES | CNC(=O)c1ccc(NCC#Cc2cc(C(=O)NC3([Si])CCN(C4CCCC4)C[C@@H]3C)c3ncn(CC(F)(F)F)c3c2)c(OC)c1 |
| InChI | InChI=1S/C33H38F3N6O3Si/c1-21-18-41(24-8-4-5-9-24)14-12-32(21,46)40-31(44)25-15-22(16-27-29(25)39-20-42(27)19-33(34,35)36)7-6-13-38-26-11-10-23(30(43)37-2)17-28(26)45-3/h10-11,15-17,20-21,24,38H,4-5,8-9,12-14,18-19H2,1-3H3,(H,37,43)(H,40,44)/t21-,32?/m0/s1 |
| InChIKey | IHIZJBOPGJBUJN-GIFGLUKTSA-N |
| XLogP | 4.31 |
| TPSA | 100.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.79 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|