C32H35F5N5O5SSi — CID 176945919
CID 176945919 (PubChem CID 176945919) has the molecular formula C32H35F5N5O5SSi and a molecular weight of 724.80 g/mol.
| Compound Name | CID 176945919 |
|---|---|
| PubChem CID | 176945919 |
| Molecular Formula | C32H35F5N5O5SSi |
| Molecular Weight | 724.80 g/mol |
| Exact Mass | 724.20 |
| IUPAC Name | — |
| SMILES | COc1cc(S(C)(=O)=O)c(F)cc1NCC#Cc1cc(C(=O)N[C@]2([Si])CCN(C3CCOCC3F)C[C@@H]2C)c2ncn(CC(F)(F)F)c2c1 |
| InChI | InChI=1S/C32H35F5N5O5SSi/c1-19-15-41(25-6-10-47-16-23(25)34)9-7-31(19,49)40-30(43)21-11-20(12-26-29(21)39-18-42(26)17-32(35,36)37)5-4-8-38-24-13-22(33)28(48(3,44)45)14-27(24)46-2/h11-14,18-19,23,25,38H,6-10,15-17H2,1-3H3,(H,40,43)/t19-,23?,25?,31-/m0/s1 |
| InChIKey | KWVHRVCAFPWNCC-QMMRMOTCSA-N |
| XLogP | 3.68 |
| TPSA | 114.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 49 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 724.80 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|