C24H28ClN3O7S2 — CID 176947297
ethyl 2-[[[5-chloro-3-[(3,4-diethoxyphenyl)-methylsulfamoyl]thiophen-2-yl]-hydroxymethyl]amino]pyridine-4-carboxylate (PubChem CID 176947297) has the molecular formula C24H28ClN3O7S2 and a molecular weight of 570.09 g/mol. Its IUPAC name is ethyl 2-[[[5-chloro-3-[(3,4-diethoxyphenyl)-methylsulfamoyl]thiophen-2-yl]-hydroxymethyl]amino]pyridine-4-carboxylate.
| Compound Name | ethyl 2-[[[5-chloro-3-[(3,4-diethoxyphenyl)-methylsulfamoyl]thiophen-2-yl]-hydroxymethyl]amino]pyridine-4-carboxylate |
|---|---|
| PubChem CID | 176947297 |
| Molecular Formula | C24H28ClN3O7S2 |
| Molecular Weight | 570.09 g/mol |
| Exact Mass | 569.11 |
| IUPAC Name | ethyl 2-[[[5-chloro-3-[(3,4-diethoxyphenyl)-methylsulfamoyl]thiophen-2-yl]-hydroxymethyl]amino]pyridine-4-carboxylate |
| SMILES | CCOC(=O)c1ccnc(NC(O)c2sc(Cl)cc2S(=O)(=O)N(C)c2ccc(OCC)c(OCC)c2)c1 |
| InChI | InChI=1S/C24H28ClN3O7S2/c1-5-33-17-9-8-16(13-18(17)34-6-2)28(4)37(31,32)19-14-20(25)36-22(19)23(29)27-21-12-15(10-11-26-21)24(30)35-7-3/h8-14,23,29H,5-7H2,1-4H3,(H,26,27) |
| InChIKey | NTEFTYWLBIQGKE-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 127.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.09 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|